Products 1261941-65-4

CAS 1261941-65-4 is the registry number for 2-(3-Pyrrolidinocarbonylphenyl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-[3-(pyrrolidine-1-carbonyl)phenyl]benzoic acid (CAS 1261941-65-4) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: 2-[3-(pyrrolidine-1-carbonyl)phenyl]benzoic acid. InChIKey: WEAJEEHNAQJXDF-UHFFFAOYSA-N.

Identity
Molecular formulaC18H17NO3
Molecular weight295.3 g/mol
IUPAC name2-[3-(pyrrolidine-1-carbonyl)phenyl]benzoic acid
InChIKeyWEAJEEHNAQJXDF-UHFFFAOYSA-N
SMILESC1CCN(C1)C(=O)C2=CC=CC(=C2)C3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)