cas: 127896-08-6 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl prop-2-yn-1-ylcarbamate, 97%, 97% (CAS 127896-08-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HRQ9-250mg |
| cas | 127896-08-6 |
| size | 250mg |
| availability | 42.7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1730.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
9H-fluoren-9-ylmethyl N-prop-2-ynylcarbamate (CAS 127896-08-6) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-prop-2-ynylcarbamate. InChIKey: WVWNQUIGNHTEJW-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-prop-2-ynylcarbamate |
| InChIKey | WVWNQUIGNHTEJW-UHFFFAOYSA-N |
| SMILES | C#CCNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)