cas: 127896-08-6 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl prop-2-yn-1-ylcarbamate, 97% (CAS 127896-08-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692306-5G |
| cas | 127896-08-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 497.76 Pln | |
| Fluorochem | 10g | 924.69 Pln | |
| Fluorochem | 25g | 1736.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
9H-fluoren-9-ylmethyl N-prop-2-ynylcarbamate (CAS 127896-08-6) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-prop-2-ynylcarbamate. InChIKey: WVWNQUIGNHTEJW-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-prop-2-ynylcarbamate |
| InChIKey | WVWNQUIGNHTEJW-UHFFFAOYSA-N |
| SMILES | C#CCNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)