cas: 3240-34-4 — see every product listed under this CAS number, including other names
(Diacetoxyiodo)benzene 97% (CAS 3240-34-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A992358-10g |
| cas | 3240-34-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 220.19 Pln | |
| Ambeed | 500g | 604.00 Pln | |
| Ambeed | 1000g | 1132.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A992358 |
[acetyloxy(phenyl)-lambda3-iodanyl] acetate (CAS 3240-34-4) is a chemical compound with the molecular formula C10H11IO4 and a molecular weight of 322.10 g/mol. IUPAC name: [acetyloxy(phenyl)-lambda3-iodanyl] acetate. InChIKey: ZBIKORITPGTTGI-UHFFFAOYSA-N.
| Molecular formula | C10H11IO4 |
|---|---|
| Molecular weight | 322.10 g/mol |
| IUPAC name | [acetyloxy(phenyl)-lambda3-iodanyl] acetate |
| InChIKey | ZBIKORITPGTTGI-UHFFFAOYSA-N |
| SMILES | CC(=O)OI(C1=CC=CC=C1)OC(=O)C |
Computed by PubChem (NCBI)