cas: 3240-34-4 — see every product listed under this CAS number, including other names
(Diacetoxyiodo)benzene (CAS 3240-34-4) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250g, 500g, 1g, 25g, 1kg. Offered by: TRC, GLPBio, Fluorochem.
| brand | TRC |
|---|---|
| catalog number | TRC-D360500-100G |
| cas | 3240-34-4 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| TRC | 100g | price on request | |
| TRC | 250g | price on request | |
| GLPBio | 500g | 690.65 Pln | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 25g | 143.72 Pln | |
| Fluorochem | 500g | 549.82 Pln | |
| Fluorochem | 1kg | 987.17 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[acetyloxy(phenyl)-lambda3-iodanyl] acetate (CAS 3240-34-4) is a chemical compound with the molecular formula C10H11IO4 and a molecular weight of 322.10 g/mol. IUPAC name: [acetyloxy(phenyl)-lambda3-iodanyl] acetate. InChIKey: ZBIKORITPGTTGI-UHFFFAOYSA-N.
| Molecular formula | C10H11IO4 |
|---|---|
| Molecular weight | 322.10 g/mol |
| IUPAC name | [acetyloxy(phenyl)-lambda3-iodanyl] acetate |
| InChIKey | ZBIKORITPGTTGI-UHFFFAOYSA-N |
| SMILES | CC(=O)OI(C1=CC=CC=C1)OC(=O)C |
Computed by PubChem (NCBI)