cas: 3240-34-4 — see every product listed under this CAS number, including other names
Iodobenzene diacetate, 98%+, 98%+ (CAS 3240-34-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 500g, 5g, 250g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149SY-10g |
| cas | 3240-34-4 |
| size | 10g |
| availability | 250000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 50g | 112.40 Pln | |
| Chemat | 500g | 451.20 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 250g | 256.40 Pln | |
| Chemat | 1kg | 822.80 Pln | |
| Chemat | 5kg | 4411.20 Pln | |
| Chemat | 100kg | price on request |
| purity | 98%+ |
|---|---|
| delivery time | 3 weeks |
[acetyloxy(phenyl)-lambda3-iodanyl] acetate (CAS 3240-34-4) is a chemical compound with the molecular formula C10H11IO4 and a molecular weight of 322.10 g/mol. IUPAC name: [acetyloxy(phenyl)-lambda3-iodanyl] acetate. InChIKey: ZBIKORITPGTTGI-UHFFFAOYSA-N.
| Molecular formula | C10H11IO4 |
|---|---|
| Molecular weight | 322.10 g/mol |
| IUPAC name | [acetyloxy(phenyl)-lambda3-iodanyl] acetate |
| InChIKey | ZBIKORITPGTTGI-UHFFFAOYSA-N |
| SMILES | CC(=O)OI(C1=CC=CC=C1)OC(=O)C |
Computed by PubChem (NCBI)