cas: 3240-34-4 — see every product listed under this CAS number, including other names
Iodobenzene diacetate, 98% (CAS 3240-34-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 5G. Offered by: Thermo Scientific (Acros), Sigma-Aldrich.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 176560250 |
| cas | 3240-34-4 |
| size | 25g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 25g | 345.67 Pln | |
| Thermo Scientific (Acros) | 100g | 953.25 Pln | |
| Thermo Scientific (Acros) | 500g | 3002.30 Pln | |
| Sigma-Aldrich | 100G | 1210.00 Pln | |
| Sigma-Aldrich | 25G | 342.00 Pln | |
| Sigma-Aldrich | 5G | 177.00 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
[acetyloxy(phenyl)-lambda3-iodanyl] acetate (CAS 3240-34-4) is a chemical compound with the molecular formula C10H11IO4 and a molecular weight of 322.10 g/mol. IUPAC name: [acetyloxy(phenyl)-lambda3-iodanyl] acetate. InChIKey: ZBIKORITPGTTGI-UHFFFAOYSA-N.
| Molecular formula | C10H11IO4 |
|---|---|
| Molecular weight | 322.10 g/mol |
| IUPAC name | [acetyloxy(phenyl)-lambda3-iodanyl] acetate |
| InChIKey | ZBIKORITPGTTGI-UHFFFAOYSA-N |
| SMILES | CC(=O)OI(C1=CC=CC=C1)OC(=O)C |
Computed by PubChem (NCBI)