(E)-3-([1,1'-Biphenyl]-4-yl)acrylic acid, 97%
cas: 88241-65-0 — see every product listed under this CAS number, including other names
(E)-3-([1,1'-Biphenyl]-4-yl)acrylic acid, 97% (CAS 88241-65-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g, 5g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A666232-1g |
| cas | 88241-65-0 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 25g | 520.56 Pln | |
| Ambeed | 100g | 1594.12 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 25g | 453.20 Pln | |
| Chemat | 100g | 1106.00 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 25g | 529.00 Pln | |
| Fluorochem | 100g | 1648.40 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 164.41 Pln | |
| BLDpharm | 25g | 547.61 Pln | |
| BLDpharm | 100g | 1713.87 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(E)-3-(4-phenylphenyl)prop-2-enoic acid (CAS 88241-65-0) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: (E)-3-(4-phenylphenyl)prop-2-enoic acid. InChIKey: DMJDEZUEYXVYNO-DHZHZOJOSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | (E)-3-(4-phenylphenyl)prop-2-enoic acid |
| InChIKey | DMJDEZUEYXVYNO-DHZHZOJOSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Phenylcinnamic acid, (E)-3-([1,1'-biphenyl]-4-yl)acrylic acid, 3-([1,1'-Biphenyl]-4-yl)acrylic acid, (2E)-3-(4-phenylphenyl)prop-2-enoic acid, (E)-3-(4-phenylphenyl)prop-2-enoic acid, 3-(4-phenylphenyl)prop-2-enoic acid, 3-[1,1'-biphenyl]-4-ylacrylic acid, 2-propenoic acid, 3-[1,1'-biphenyl]-4-yl-, (2E)-, 3-[1,1'-Biphenyl]-4-yl-2-propenoic acid, AldrichCPR, (2E)-3-biphenyl-4-ylacrylic acid