CAS 1143-20-0 appears in our catalog under these names: 9,10-Dihydroanthracene-9-carboxylic acid, 98%, 9,10-Dihydroanthracene-9-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
9,10-dihydroanthracene-9-carboxylic acid (CAS 1143-20-0) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: 9,10-dihydroanthracene-9-carboxylic acid. InChIKey: HAMMHSUBQYOIFQ-UHFFFAOYSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 9,10-dihydroanthracene-9-carboxylic acid |
| InChIKey | HAMMHSUBQYOIFQ-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(C3=CC=CC=C31)C(=O)O |
Computed by PubChem (NCBI)