Products 88241-65-0
CAS 88241-65-0 is the registry number for (E)-3-([1,1'-Biphenyl]-4-yl)acrylic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm. Available pack sizes: 1g, 25g, 100g, 5g.
(E)-3-(4-phenylphenyl)prop-2-enoic acid (CAS 88241-65-0) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: (E)-3-(4-phenylphenyl)prop-2-enoic acid. InChIKey: DMJDEZUEYXVYNO-DHZHZOJOSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | (E)-3-(4-phenylphenyl)prop-2-enoic acid |
| InChIKey | DMJDEZUEYXVYNO-DHZHZOJOSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Phenylcinnamic acid, (E)-3-([1,1'-biphenyl]-4-yl)acrylic acid, 3-([1,1'-Biphenyl]-4-yl)acrylic acid, (2E)-3-(4-phenylphenyl)prop-2-enoic acid, (E)-3-(4-phenylphenyl)prop-2-enoic acid, 3-(4-phenylphenyl)prop-2-enoic acid, 3-[1,1'-biphenyl]-4-ylacrylic acid, 2-propenoic acid, 3-[1,1'-biphenyl]-4-yl-, (2E)-, 3-[1,1'-Biphenyl]-4-yl-2-propenoic acid, AldrichCPR, (2E)-3-biphenyl-4-ylacrylic acid