Products 939-58-2
CAS 939-58-2 appears in our catalog under these names: (E)-3-(2-Chlorophenyl)acrylic acid, (E)-3-(2-Chlorophenyl)acrylic acid, 98%, (E)-3-(2-Chlorophenyl)acrylic acid, 95%, 95%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 2,5g, 0,25g, 100mg, 250mg, 1g, 5g.
(E)-3-(2-chlorophenyl)prop-2-enoic acid (CAS 939-58-2) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: (E)-3-(2-chlorophenyl)prop-2-enoic acid. InChIKey: KJRRTHHNKJBVBO-AATRIKPKSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | (E)-3-(2-chlorophenyl)prop-2-enoic acid |
| InChIKey | KJRRTHHNKJBVBO-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-Chlorocinnamic acid, o-Chlorocinnamic acid, CINNAMIC ACID, o-CHLORO-, 2-Propenoic acid, 3-(2-chlorophenyl)-, 3-(2-Chlorophenyl)-2-propenoic acid, trans-2-chlorocinnamic acid, (E)-3-(2-Chlorophenyl)acrylic acid, (E)-3-(2-chlorophenyl)prop-2-enoic acid, 3-(2-chlorophenyl)acrylic acid, (2E)-3-(2-Chlorophenyl)-2-propenoic acid