CAS 10557-21-8 appears in our catalog under these names: 1-(4-Chlorophenyl)propane-1,2-dione, 95%, 1-(4-Chlorophenyl)propane-1,2-dione 95%, 1-(4-Chlorophenyl)propane-1,2-dione, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 100mg, 5g, 10g.
1-(4-chlorophenyl)propane-1,2-dione (CAS 10557-21-8) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 1-(4-chlorophenyl)propane-1,2-dione. InChIKey: HOZREFFNUJAHQP-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 1-(4-chlorophenyl)propane-1,2-dione |
| InChIKey | HOZREFFNUJAHQP-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)