Products 127839-23-0
CAS 127839-23-0 appears in our catalog under these names: 8-Chlorocubane-1-carboxylic acid, 95%, 8-Chlorocubane-1-carboxylic acid 98%, 8-Chlorocubane-1-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
4-chlorocubane-1-carboxylic acid (CAS 127839-23-0) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 4-chlorocubane-1-carboxylic acid. InChIKey: QOGGYQLCQAJNEP-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 4-chlorocubane-1-carboxylic acid |
| InChIKey | QOGGYQLCQAJNEP-UHFFFAOYSA-N |
| SMILES | C12C3C4C1(C5C2C3(C45)Cl)C(=O)O |
Computed by PubChem (NCBI)