CAS 1199782-82-5 appears in our catalog under these names: 5-Chloro-4-chromanone, 95%, 5-Chloro-4-chromanone, 98%, 98%, 5-Chloro-2,3-dihydrochromen-4-one, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
5-chloro-2,3-dihydrochromen-4-one (CAS 1199782-82-5) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 5-chloro-2,3-dihydrochromen-4-one. InChIKey: XNDCOZXJBUCGSS-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 5-chloro-2,3-dihydrochromen-4-one |
| InChIKey | XNDCOZXJBUCGSS-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C(=CC=C2)Cl |
Computed by PubChem (NCBI)