cas: 2387419-80-7 — see every product listed under this CAS number, including other names
(E)-3-(4-chloro-3,5-dimethylphenyl)acrylic acid, ≥95%, ≥95% (CAS 2387419-80-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132PQK-1g |
| cas | 2387419-80-7 |
| size | 1g |
| availability | 12g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1653.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(E)-3-(4-chloro-3,5-dimethylphenyl)prop-2-enoic acid (CAS 2387419-80-7) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: (E)-3-(4-chloro-3,5-dimethylphenyl)prop-2-enoic acid. InChIKey: FODFWRMFSXKREK-ONEGZZNKSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | (E)-3-(4-chloro-3,5-dimethylphenyl)prop-2-enoic acid |
| InChIKey | FODFWRMFSXKREK-ONEGZZNKSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)C)/C=C/C(=O)O |
Computed by PubChem (NCBI)