cas: 2387419-80-7 — see every product listed under this CAS number, including other names
3-(4-Chloro-3,5-dimethylphenyl)acrylic acid, 98% (CAS 2387419-80-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1658313-5g |
| cas | 2387419-80-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 14541.73 Pln | |
| AmBeed | 10g | 24697.33 Pln | |
| AmBeed | 25g | 48478.36 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(E)-3-(4-chloro-3,5-dimethylphenyl)prop-2-enoic acid (CAS 2387419-80-7) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: (E)-3-(4-chloro-3,5-dimethylphenyl)prop-2-enoic acid. InChIKey: FODFWRMFSXKREK-ONEGZZNKSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | (E)-3-(4-chloro-3,5-dimethylphenyl)prop-2-enoic acid |
| InChIKey | FODFWRMFSXKREK-ONEGZZNKSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)C)/C=C/C(=O)O |
Computed by PubChem (NCBI)