cas: 165059-42-7 — see every product listed under this CAS number, including other names
(E)-3-Methoxy-1-propen-1-ylboronic acid, pinacol ester, 98%(stabilized with TBC), 98%(stabilized with TBC) (CAS 165059-42-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C1N-100mg |
| cas | 165059-42-7 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 1158.80 Pln | |
| Chemat | 25g | 4072.40 Pln |
| purity | 98%(stabilized with TBC) |
|---|---|
| delivery time | 3 weeks |
2-[(E)-3-methoxyprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 165059-42-7) is a chemical compound with the molecular formula C10H19BO3 and a molecular weight of 198.07 g/mol. IUPAC name: 2-[(E)-3-methoxyprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FBAOFKFCKHJXRU-VOTSOKGWSA-N.
| Molecular formula | C10H19BO3 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | 2-[(E)-3-methoxyprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FBAOFKFCKHJXRU-VOTSOKGWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/COC |
Computed by PubChem (NCBI)