CAS 2287240-96-2 is the registry number for rel-((1R,2R)-2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl)methanol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methanol (CAS 2287240-96-2) is a chemical compound with the molecular formula C10H19BO3 and a molecular weight of 198.07 g/mol. IUPAC name: [(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methanol. InChIKey: MDHNDTVRXDFFEA-JGVFFNPUSA-N.
| Molecular formula | C10H19BO3 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | [(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methanol |
| InChIKey | MDHNDTVRXDFFEA-JGVFFNPUSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)[C@@H]2C[C@H]2CO |
Computed by PubChem (NCBI)