CAS 1360111-87-0 appears in our catalog under these names: 2–(2–Ethoxyvinyl)–4,4,5,5–tetramethyl–1,3,2–dioxaborolane, 2-(2-Ethoxyvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%, 2-(2-Ethoxyvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (stabilized with TBC). Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 1g, 250mg, 25g, 100g, 250g, 100mg, 5g, 10g.
2-[(E)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1360111-87-0) is a chemical compound with the molecular formula C10H19BO3 and a molecular weight of 198.07 g/mol. IUPAC name: 2-[(E)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MRAYNLYCQPAZJN-BQYQJAHWSA-N.
| Molecular formula | C10H19BO3 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | 2-[(E)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MRAYNLYCQPAZJN-BQYQJAHWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/OCC |
Computed by PubChem (NCBI)