CAS 1008752-03-1 appears in our catalog under these names: (Z)-3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-1-ol, 98%, 98%, (Z)-(4-HYDROXY-2-BUTEN-2-YL)BORONIC ACID PINACOL ESTER, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-1-ol (CAS 1008752-03-1) is a chemical compound with the molecular formula C10H19BO3 and a molecular weight of 198.07 g/mol. IUPAC name: (Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-1-ol. InChIKey: VNNHUQAJHVXMJC-SOFGYWHQSA-N.
| Molecular formula | C10H19BO3 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | (Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-1-ol |
| InChIKey | VNNHUQAJHVXMJC-SOFGYWHQSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C(=C/CO)/C |
Computed by PubChem (NCBI)