CAS 331958-88-4 appears in our catalog under these names: 4,4,5,5-tetramethyl-2-tetrahydrofuran-2-yl-1,3,2-dioxaborolane, 98%, 98%, 4,4,5,5-Tetramethyl-2-tetrahydrofuran-2-yl-1,3,2-dioxaborolane, 98%, 4,4,5,5-Tetramethyl-2-(tetrahydrofuran-2-yl)-1,3,2-dioxaborolane, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,4,5,5-tetramethyl-2-(oxolan-2-yl)-1,3,2-dioxaborolane (CAS 331958-88-4) is a chemical compound with the molecular formula C10H19BO3 and a molecular weight of 198.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(oxolan-2-yl)-1,3,2-dioxaborolane. InChIKey: NRIHVWDOPTVSAN-UHFFFAOYSA-N.
| Molecular formula | C10H19BO3 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(oxolan-2-yl)-1,3,2-dioxaborolane |
| InChIKey | NRIHVWDOPTVSAN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCO2 |
Computed by PubChem (NCBI)