cas: 2169-68-8 — see every product listed under this CAS number, including other names
(E)-Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate (CAS 2169-68-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F449091-5G |
| cas | 2169-68-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1549.47 Pln | |
| Fluorochem | 25g | 4501.56 Pln |
| delivery time | 3-4 weeks |
|---|
Ethyl (E)-3-(4-chlorophenyl)-2-cyanoprop-2-enoate (CAS 2169-68-8) is a chemical compound with the molecular formula C12H10ClNO2 and a molecular weight of 235.66 g/mol. IUPAC name: ethyl (E)-3-(4-chlorophenyl)-2-cyanoprop-2-enoate. InChIKey: KLUDCHZOLVGLQF-JXMROGBWSA-N.
| Molecular formula | C12H10ClNO2 |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | ethyl (E)-3-(4-chlorophenyl)-2-cyanoprop-2-enoate |
| InChIKey | KLUDCHZOLVGLQF-JXMROGBWSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC=C(C=C1)Cl)/C#N |
Computed by PubChem (NCBI)