CAS 1234818-35-9 appears in our catalog under these names: Methyl 4-chloro-2-methylquinoline-8-carboxylate, 95%, Methyl 4–chloro–2–methylquinoline–8–carboxylate. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
Methyl 4-chloro-2-methylquinoline-8-carboxylate (CAS 1234818-35-9) is a chemical compound with the molecular formula C12H10ClNO2 and a molecular weight of 235.66 g/mol. IUPAC name: methyl 4-chloro-2-methylquinoline-8-carboxylate. InChIKey: XGKKOOISRLHZEN-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2 |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | methyl 4-chloro-2-methylquinoline-8-carboxylate |
| InChIKey | XGKKOOISRLHZEN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC=C(C2=N1)C(=O)OC)Cl |
Computed by PubChem (NCBI)