CAS 948290-22-0 is the registry number for 7-Chloro-2,8-dimethylquinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
7-chloro-2,8-dimethylquinoline-3-carboxylic acid (CAS 948290-22-0) is a chemical compound with the molecular formula C12H10ClNO2 and a molecular weight of 235.66 g/mol. IUPAC name: 7-chloro-2,8-dimethylquinoline-3-carboxylic acid. InChIKey: XXJOAECAXTVYHG-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2 |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 7-chloro-2,8-dimethylquinoline-3-carboxylic acid |
| InChIKey | XXJOAECAXTVYHG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=CC(=C(N=C12)C)C(=O)O)Cl |
Computed by PubChem (NCBI)