CAS 948294-07-3 is the registry number for 5-Chloro-2,8-dimethylquinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-chloro-2,8-dimethylquinoline-3-carboxylic acid (CAS 948294-07-3) is a chemical compound with the molecular formula C12H10ClNO2 and a molecular weight of 235.66 g/mol. IUPAC name: 5-chloro-2,8-dimethylquinoline-3-carboxylic acid. InChIKey: SHGJKLOQJDLYBG-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2 |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 5-chloro-2,8-dimethylquinoline-3-carboxylic acid |
| InChIKey | SHGJKLOQJDLYBG-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Cl)C=C(C(=N2)C)C(=O)O |
Computed by PubChem (NCBI)