Products 2309463-57-6

CAS 2309463-57-6 is the registry number for 3-Phenylpyridine-4-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-phenylpyridine-4-carboxylic acid;hydrochloride (CAS 2309463-57-6) is a chemical compound with the molecular formula C12H10ClNO2 and a molecular weight of 235.66 g/mol. IUPAC name: 3-phenylpyridine-4-carboxylic acid;hydrochloride. InChIKey: RKRHEXASBMTERG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10ClNO2
Molecular weight235.66 g/mol
IUPAC name3-phenylpyridine-4-carboxylic acid;hydrochloride
InChIKeyRKRHEXASBMTERG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=C(C=CN=C2)C(=O)O.Cl

Computed by PubChem (NCBI)