CAS 2059932-87-3 appears in our catalog under these names: 2-(pyridin-4-yl)benzoic acid hydrochloride, 95%, 2-(Pyridin-4-yl)benzoic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
2-pyridin-4-ylbenzoic acid;hydrochloride (CAS 2059932-87-3) is a chemical compound with the molecular formula C12H10ClNO2 and a molecular weight of 235.66 g/mol. IUPAC name: 2-pyridin-4-ylbenzoic acid;hydrochloride. InChIKey: RLESHHIZKAWJTR-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2 |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 2-pyridin-4-ylbenzoic acid;hydrochloride |
| InChIKey | RLESHHIZKAWJTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=NC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)