CAS 1394969-41-5 appears in our catalog under these names: 4-chloro-3-(pyridin-3-ylmethoxy)phenol, 95%, 4-Chloro-3-(pyridin-3-ylmethoxy)phenol 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 50mg, 100mg, 250mg.
4-chloro-3-(pyridin-3-ylmethoxy)phenol (CAS 1394969-41-5) is a chemical compound with the molecular formula C12H10ClNO2 and a molecular weight of 235.66 g/mol. IUPAC name: 4-chloro-3-(pyridin-3-ylmethoxy)phenol. InChIKey: KBDDWIJDYKJMMX-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2 |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 4-chloro-3-(pyridin-3-ylmethoxy)phenol |
| InChIKey | KBDDWIJDYKJMMX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)COC2=C(C=CC(=C2)O)Cl |
Computed by PubChem (NCBI)