cas: 3959-23-7 — see every product listed under this CAS number, including other names
(Phenylsulfonyl)Acetic Acid, 96%, 96% (CAS 3959-23-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C2V-100mg |
| cas | 3959-23-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 10g | 453.20 Pln | |
| Chemat | 25g | 885.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(benzenesulfonyl)acetic acid (CAS 3959-23-7) is a chemical compound with the molecular formula C8H8O4S and a molecular weight of 200.21 g/mol. IUPAC name: 2-(benzenesulfonyl)acetic acid. InChIKey: YTEFAALYDTWTLB-UHFFFAOYSA-N.
| Molecular formula | C8H8O4S |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 2-(benzenesulfonyl)acetic acid |
| InChIKey | YTEFAALYDTWTLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CC(=O)O |
Computed by PubChem (NCBI)