CAS 4052-30-6 appears in our catalog under these names: 4-(methylsulfonyl) Benzoic Acid, 4–(Methylsulfonyl)benzoic Acid, 4-(Methylsulfonyl)benzoic acid, 98% , 4-(Methylsulfonyl)benzoic Acid, >98.0%(GC)(T), 4-(Methylsulfonyl)benzoic acid 97%. Offered by: Chemat Brand, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: on request, 100g, 500g, 1g, 5g, 25g, 10g.
4-methylsulfonylbenzoic acid (CAS 4052-30-6) is a chemical compound with the molecular formula C8H8O4S and a molecular weight of 200.21 g/mol. IUPAC name: 4-methylsulfonylbenzoic acid. InChIKey: AJBWNNKDUMXZLM-UHFFFAOYSA-N.
| Molecular formula | C8H8O4S |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 4-methylsulfonylbenzoic acid |
| InChIKey | AJBWNNKDUMXZLM-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)