cas: 193693-63-9 — see every product listed under this CAS number, including other names
(R)-(1-FMOC-PIPERIDIN-2-YL)-ACETIC ACID, 97%, 97% (CAS 193693-63-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AE7E-100mg |
| cas | 193693-63-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 990.80 Pln | |
| Chemat | 10g | 1917.20 Pln | |
| Chemat | 25g | 4701.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[(2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-2-yl]acetic acid (CAS 193693-63-9) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 2-[(2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-2-yl]acetic acid. InChIKey: YVHXTQQJFAOBCJ-OAHLLOKOSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 2-[(2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-2-yl]acetic acid |
| InChIKey | YVHXTQQJFAOBCJ-OAHLLOKOSA-N |
| SMILES | C1CCN([C@H](C1)CC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)