cas: 193693-63-9 — see every product listed under this CAS number, including other names
(R)-1-Fmoc-2-piperidineacetic acid 97% (CAS 193693-63-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A146713-100mg |
| cas | 193693-63-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1310.44 Pln | |
| Ambeed | 25g | 4291.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A146713 |
2-[(2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-2-yl]acetic acid (CAS 193693-63-9) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 2-[(2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-2-yl]acetic acid. InChIKey: YVHXTQQJFAOBCJ-OAHLLOKOSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 2-[(2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-2-yl]acetic acid |
| InChIKey | YVHXTQQJFAOBCJ-OAHLLOKOSA-N |
| SMILES | C1CCN([C@H](C1)CC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)