cas: 75433-76-0 — see every product listed under this CAS number, including other names
(R)-1,2,3,4-Tetrahydroquinoline-2-carboxylic acid hydrochloride 95% (CAS 75433-76-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A310124-50mg |
| cas | 75433-76-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 470.50 Pln | |
| Ambeed | 100mg | 743.06 Pln | |
| Ambeed | 250mg | 1377.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A310124 |
(2R)-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride (CAS 75433-76-0) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: (2R)-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride. InChIKey: QCFTXGXKUNDYFE-SBSPUUFOSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | (2R)-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride |
| InChIKey | QCFTXGXKUNDYFE-SBSPUUFOSA-N |
| SMILES | C1CC2=CC=CC=C2N[C@H]1C(=O)O.Cl |
Computed by PubChem (NCBI)