CAS 1211618-19-7 appears in our catalog under these names: 1-Amino-2,3-dihydro-1h-indene-1-carboxylic acid hydrochloride, 95%, 1-Amino-2,3-dihydro-1H-indene-1-carboxylic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 0,5g.
1-amino-2,3-dihydroindene-1-carboxylic acid;hydrochloride (CAS 1211618-19-7) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 1-amino-2,3-dihydroindene-1-carboxylic acid;hydrochloride. InChIKey: PKWJOVLAHBCCTC-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 1-amino-2,3-dihydroindene-1-carboxylic acid;hydrochloride |
| InChIKey | PKWJOVLAHBCCTC-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C21)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)