Products 1187928-05-7

CAS 1187928-05-7 appears in our catalog under these names: Methyl indoline-6-carboxylate hydrochloride, 95%, Methyl indoline–6–carboxylate hydrochloride, 2,3-Dihydro-1H-indole-6-carboxylic acid methyl ester hydrochloride, Methyl indoline-6-carboxylate hydrochloride, 97%, 97%, Methyl indoline-6-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 2,5g, 100mg, 500mg, 2.5g.

Structural formula: {0} (CAS {1})

Methyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride (CAS 1187928-05-7) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: methyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride. InChIKey: YRVKTOXGFFZLCT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO2
Molecular weight213.66 g/mol
IUPAC namemethyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride
InChIKeyYRVKTOXGFFZLCT-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC2=C(CCN2)C=C1.Cl

Computed by PubChem (NCBI)