cas: 75433-76-0 — see every product listed under this CAS number, including other names
(R)-1,2,3,4-Tetrahydroquinoline-2-carboxylic acid hydrochloride, 95%, 95% (CAS 75433-76-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116L4S-50mg |
| cas | 75433-76-0 |
| size | 50mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 419.60 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 1245.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride (CAS 75433-76-0) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: (2R)-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride. InChIKey: QCFTXGXKUNDYFE-SBSPUUFOSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | (2R)-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride |
| InChIKey | QCFTXGXKUNDYFE-SBSPUUFOSA-N |
| SMILES | C1CC2=CC=CC=C2N[C@H]1C(=O)O.Cl |
Computed by PubChem (NCBI)