Products 1187927-40-7

CAS 1187927-40-7 appears in our catalog under these names: 2,3-Dihydro-1h-indole-4-carboxylic acid methyl ester hydrochloride, 95%, Methyl indoline–4–carboxylate hydrochloride, 2,3-Dihydro-1H-indole-4-carboxylic acid methyl ester hydrochloride, Methyl indoline-4-carboxylate hydrochloride 97%, 2,3-Dihydro-1H-indole-4-carboxylic acid methyl ester hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 2,5g.

Structural formula: {0} (CAS {1})

Methyl 2,3-dihydro-1H-indole-4-carboxylate;hydrochloride (CAS 1187927-40-7) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: methyl 2,3-dihydro-1H-indole-4-carboxylate;hydrochloride. InChIKey: SBSHOJQKDISHLU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO2
Molecular weight213.66 g/mol
IUPAC namemethyl 2,3-dihydro-1H-indole-4-carboxylate;hydrochloride
InChIKeySBSHOJQKDISHLU-UHFFFAOYSA-N
SMILESCOC(=O)C1=C2CCNC2=CC=C1.Cl

Computed by PubChem (NCBI)