Products 270596-41-3
CAS 270596-41-3 appears in our catalog under these names: (S)-3-Amino-4-(4-chlorophenyl)butanoic acid hydrochloride, 98%, (S)-3-Amino-4-(4-chlorophenyl)butanoic acid, 95%, (S)-3-Amino-4-(4-chlorophenyl)butanoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 10g, 1g, 25g, 100mg.
(3S)-3-amino-4-(4-chlorophenyl)butanoic acid (CAS 270596-41-3) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: (3S)-3-amino-4-(4-chlorophenyl)butanoic acid. InChIKey: LCYHDQUYYVDIPY-VIFPVBQESA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | (3S)-3-amino-4-(4-chlorophenyl)butanoic acid |
| InChIKey | LCYHDQUYYVDIPY-VIFPVBQESA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](CC(=O)O)N)Cl |
Computed by PubChem (NCBI)
Synonyms:
(betaS)-beta-Amino-4-chlorobenzenebutanoic acid, (S)-3-Amino-4-(4-chlorophenyl)butanoic acid, (3S)-3-amino-4-(4-chlorophenyl)butanoic Acid, (s)-3-amino-4-(4-chlorophenyl)butyric acid, H-beta-HPhe(4-Cl)-OH HCl, (s)-3-amino-4-(4-chlorophenyl)-butyric acid, (I(2)S)-I(2)-Amino-4-chlorobenzenebutanoic acid, (S)-3-Amino-4-(4-chloro-phenyl)-butyric acid hydrochloridel