Products 412924-78-8

CAS 412924-78-8 is the registry number for 2-Amino-2-(3-chlorophenyl)butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-amino-2-(3-chlorophenyl)butanoic acid (CAS 412924-78-8) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 2-amino-2-(3-chlorophenyl)butanoic acid. InChIKey: PSTBLRIBNXXEBS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO2
Molecular weight213.66 g/mol
IUPAC name2-amino-2-(3-chlorophenyl)butanoic acid
InChIKeyPSTBLRIBNXXEBS-UHFFFAOYSA-N
SMILESCCC(C1=CC(=CC=C1)Cl)(C(=O)O)N

Computed by PubChem (NCBI)