CAS 75493-93-5 appears in our catalog under these names: 1,2,3,4–tetrahydroquinoline–2–carboxylicacidhydrochloride, 1,2,3,4-Tetrahydroquinoline-2-carboxylic acid HCl, 1,2,3,4-Tetrahydroquinoline-2-carboxylic acid hydrochloride 95%, 1,2,3,4-Tetrahydroquinoline-2-carboxylic acid hydrochloride, 95%, 95%, 1,2,3,4-TETRAHYDROQUINOLINE-2-CARBOXYLIC ACID HCL, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 5g.
1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride (CAS 75493-93-5) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride. InChIKey: QCFTXGXKUNDYFE-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride |
| InChIKey | QCFTXGXKUNDYFE-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2NC1C(=O)O.Cl |
Computed by PubChem (NCBI)