cas: 374791-02-3 — see every product listed under this CAS number, including other names
(R)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)azetidine-2-carboxylic acid, 95% (CAS 374791-02-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338042-1G |
| cas | 374791-02-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 799.74 Pln | |
| Fluorochem | 10g | 1544.27 Pln | |
| Fluorochem | 25g | 3106.22 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid (CAS 374791-02-3) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: (2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid. InChIKey: BXRZCDISGRVJCA-QGZVFWFLSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | (2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid |
| InChIKey | BXRZCDISGRVJCA-QGZVFWFLSA-N |
| SMILES | C1CN([C@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)