cas: 1257106-72-1 — see every product listed under this CAS number, including other names
(R)-1-(3,5-Dimethoxyphenyl)ethanamine hydrochloride, 98% (CAS 1257106-72-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F695166-100MG |
| cas | 1257106-72-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 1502.61 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-1-(3,5-dimethoxyphenyl)ethanamine;hydrochloride (CAS 1257106-72-1) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: (1R)-1-(3,5-dimethoxyphenyl)ethanamine;hydrochloride. InChIKey: YUPSTPMVIYAHMF-OGFXRTJISA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (1R)-1-(3,5-dimethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | YUPSTPMVIYAHMF-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)