Products 97294-79-6
CAS 97294-79-6 appears in our catalog under these names: 1-(3,5-DIMETHOXYPHENYL)ETHAN-1-AMINE HYDROCHLORIDE, 97%, 97%, 1-(3,5-Dimethoxyphenyl)ethanamine hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(3,5-dimethoxyphenyl)ethanamine;hydrochloride (CAS 97294-79-6) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: 1-(3,5-dimethoxyphenyl)ethanamine;hydrochloride. InChIKey: YUPSTPMVIYAHMF-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | 1-(3,5-dimethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | YUPSTPMVIYAHMF-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)