cas: 160347-90-0 — see every product listed under this CAS number, including other names
(R)-1-(tert-Butoxycarbonyl)-5-oxopyrrolidine-2-carboxylic acid, 95% (CAS 160347-90-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223996-1G |
| cas | 160347-90-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxopyrrolidine-2-carboxylic acid (CAS 160347-90-0) is a chemical compound with the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. IUPAC name: (2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxopyrrolidine-2-carboxylic acid. InChIKey: MJLQPFJGZTYCMH-ZCFIWIBFSA-N.
| Molecular formula | C10H15NO5 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | (2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxopyrrolidine-2-carboxylic acid |
| InChIKey | MJLQPFJGZTYCMH-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CCC1=O)C(=O)O |
Computed by PubChem (NCBI)