CAS 160347-90-0 appears in our catalog under these names: Boc-D-Pyr-OH, 95%, Boc–D–Pyr–OH, Boc-D-Pyr-OH, N-Boc-5-oxo-D-proline, 97% , Boc-D-Pyr-OH 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Ambeed. Available pack sizes: 10g, 5g, 25g, 1g, 100g.
(2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxopyrrolidine-2-carboxylic acid (CAS 160347-90-0) is a chemical compound with the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. IUPAC name: (2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxopyrrolidine-2-carboxylic acid. InChIKey: MJLQPFJGZTYCMH-ZCFIWIBFSA-N.
| Molecular formula | C10H15NO5 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | (2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxopyrrolidine-2-carboxylic acid |
| InChIKey | MJLQPFJGZTYCMH-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CCC1=O)C(=O)O |
Computed by PubChem (NCBI)