CAS 2420-13-5 appears in our catalog under these names: (S)-3-N-Boc-amino-dihydro-pyran-2,6-dione, 97%, (S)-tert-Butyl (2,6-dioxotetrahydro-2H-pyran-3-yl)carbamate 97%, (S)-tert-Butyl (2,6-dioxotetrahydro-2H-pyran-3-yl)carbamate, 97%, 97%, (S)-3-N-Boc-Amino-dihydro-pyran-2,6-dione, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
Tert-butyl N-[(3S)-2,6-dioxooxan-3-yl]carbamate (CAS 2420-13-5) is a chemical compound with the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. IUPAC name: tert-butyl N-[(3S)-2,6-dioxooxan-3-yl]carbamate. InChIKey: XPWLCDJCIMBIBS-LURJTMIESA-N.
| Molecular formula | C10H15NO5 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | tert-butyl N-[(3S)-2,6-dioxooxan-3-yl]carbamate |
| InChIKey | XPWLCDJCIMBIBS-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC(=O)OC1=O |
Computed by PubChem (NCBI)