CAS 41372-08-1 appears in our catalog under these names: L-Alpha-Methyl DOPA Hydrate, >95% (HPLC), Methyldopa Sesquihydrate, Methyldopa hydrate, (-)-3,4-Dihydroxy-alpha-methyl-L-phenylalanine sesquihydrate, (-)-3-(3,4-DIHYDROXYPHENYL)-2-METHYL-L-A. Offered by: TRC, Mikromol, LoGiCal, TargetMol, Thermo Scientific (Alfa Aesar). Available pack sizes: 10g, 2,5g, 250mg, 10mg, 1g, 500mg, 5g, 25g.
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;hydrate (CAS 41372-08-1) is a chemical compound with the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. IUPAC name: (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;hydrate. InChIKey: XDJUBZFLFDODNF-PPHPATTJSA-N.
| Molecular formula | C10H15NO5 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;hydrate |
| InChIKey | XDJUBZFLFDODNF-PPHPATTJSA-N |
| SMILES | C[C@](CC1=CC(=C(C=C1)O)O)(C(=O)O)N.O |
Computed by PubChem (NCBI)