CAS 146551-23-7 appears in our catalog under these names: Mal-peg3-alcohol, 95%, Mal-PEG3-alcohol, Mal–PEG3–alcohol, Mal-PEG3-alcohol 97% +MEHQ(0.1%), 1-(2-(2-(2-Hydroxyethoxy)ethoxy)ethyl)-1H-pyrrole-2,5-dione, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 500mg, 1g, 250mg, 100 mg, 10 mg, 5 mg, 1 g.
1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]pyrrole-2,5-dione (CAS 146551-23-7) is a chemical compound with the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. IUPAC name: 1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]pyrrole-2,5-dione. InChIKey: DRANPRSEAZUMPF-UHFFFAOYSA-N.
| Molecular formula | C10H15NO5 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]pyrrole-2,5-dione |
| InChIKey | DRANPRSEAZUMPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCO |
Computed by PubChem (NCBI)