Products 3751-82-4

CAS 3751-82-4 is the registry number for 4-Oxo-pyrrolidine-1,3-dicarboxylic acid diethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Diethyl 4-oxopyrrolidine-1,3-dicarboxylate (CAS 3751-82-4) is a chemical compound with the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. IUPAC name: diethyl 4-oxopyrrolidine-1,3-dicarboxylate. InChIKey: HJSVNVFKQKIQFI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15NO5
Molecular weight229.23 g/mol
IUPAC namediethyl 4-oxopyrrolidine-1,3-dicarboxylate
InChIKeyHJSVNVFKQKIQFI-UHFFFAOYSA-N
SMILESCCOC(=O)C1CN(CC1=O)C(=O)OCC

Computed by PubChem (NCBI)