CAS 357610-32-3 appears in our catalog under these names: N-Boc-beta-alanine-alpha-methyl-n-carboxyanhydride, 95%, tert-Butyl 5-methyl-2,6-dioxo-1,3-oxazinane-3-carboxylate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Tert-butyl 5-methyl-2,6-dioxo-1,3-oxazinane-3-carboxylate (CAS 357610-32-3) is a chemical compound with the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. IUPAC name: tert-butyl 5-methyl-2,6-dioxo-1,3-oxazinane-3-carboxylate. InChIKey: ICAVRDITSQWMAM-UHFFFAOYSA-N.
| Molecular formula | C10H15NO5 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | tert-butyl 5-methyl-2,6-dioxo-1,3-oxazinane-3-carboxylate |
| InChIKey | ICAVRDITSQWMAM-UHFFFAOYSA-N |
| SMILES | CC1CN(C(=O)OC1=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)